C34H40N2 — CID 87912136
1-N,2-N-bis(3-pent-1-ynylphenyl)dodec-3-yne-1,2-diimine (PubChem CID 87912136) has the molecular formula C34H40N2 and a molecular weight of 476.71 g/mol. Its IUPAC name is 1-N,2-N-bis(3-pent-1-ynylphenyl)dodec-3-yne-1,2-diimine.
| Compound Name | 1-N,2-N-bis(3-pent-1-ynylphenyl)dodec-3-yne-1,2-diimine |
|---|---|
| PubChem CID | 87912136 |
| Molecular Formula | C34H40N2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 1-N,2-N-bis(3-pent-1-ynylphenyl)dodec-3-yne-1,2-diimine |
| SMILES | CCCC#Cc1cccc(/N=C/C(C#CCCCCCCCC)=N/c2cccc(C#CCCC)c2)c1 |
| InChI | InChI=1S/C34H40N2/c1-4-7-10-11-12-13-14-17-24-34(36-33-26-19-23-31(28-33)21-16-9-6-3)29-35-32-25-18-22-30(27-32)20-15-8-5-2/h18-19,22-23,25-29H,4-14H2,1-3H3/b35-29+,36-34+ |
| InChIKey | VIKVAHBHXFLWAF-GBGJXMMJSA-N |
| XLogP | 9.22 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|