C38H56N2 — CID 22045998
1-N,2-N-bis(3,4-dibutylphenyl)dec-3-yne-1,2-diimine (PubChem CID 22045998) has the molecular formula C38H56N2 and a molecular weight of 540.88 g/mol. Its IUPAC name is 1-N,2-N-bis(3,4-dibutylphenyl)dec-3-yne-1,2-diimine.
| Compound Name | 1-N,2-N-bis(3,4-dibutylphenyl)dec-3-yne-1,2-diimine |
|---|---|
| PubChem CID | 22045998 |
| Molecular Formula | C38H56N2 |
| Molecular Weight | 540.88 g/mol |
| Exact Mass | 540.44 |
| IUPAC Name | 1-N,2-N-bis(3,4-dibutylphenyl)dec-3-yne-1,2-diimine |
| SMILES | CCCCCCC#CC(/C=N/c1ccc(CCCC)c(CCCC)c1)=N\c1ccc(CCCC)c(CCCC)c1 |
| InChI | InChI=1S/C38H56N2/c1-6-11-16-17-18-19-24-38(40-37-28-26-33(21-13-8-3)35(30-37)23-15-10-5)31-39-36-27-25-32(20-12-7-2)34(29-36)22-14-9-4/h25-31H,6-18,20-23H2,1-5H3/b39-31+,40-38+ |
| InChIKey | KVYFMGREVDNHNN-CQHNONCRSA-N |
| XLogP | 11.51 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.88 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|