C30H44N2Pd — CID 87911382
N,N'-bis(3,4-dibutylphenyl)ethane-1,2-diimine;palladium (PubChem CID 87911382) has the molecular formula C30H44N2Pd and a molecular weight of 539.12 g/mol. Its IUPAC name is N,N'-bis(3,4-dibutylphenyl)ethane-1,2-diimine;palladium.
| Compound Name | N,N'-bis(3,4-dibutylphenyl)ethane-1,2-diimine;palladium |
|---|---|
| PubChem CID | 87911382 |
| Molecular Formula | C30H44N2Pd |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | N,N'-bis(3,4-dibutylphenyl)ethane-1,2-diimine;palladium |
| SMILES | CCCCc1ccc(/N=C/C=N/c2ccc(CCCC)c(CCCC)c2)cc1CCCC.[Pd] |
| InChI | InChI=1S/C30H44N2.Pd/c1-5-9-13-25-17-19-29(23-27(25)15-11-7-3)31-21-22-32-30-20-18-26(14-10-6-2)28(24-30)16-12-8-4;/h17-24H,5-16H2,1-4H3;/b31-21+,32-22+; |
| InChIKey | ARDPPHCRYQKUDE-XGUYBVJSSA-N |
| XLogP | 9.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|