C30H44N2 — CID 87875232
N,N'-bis(3,5-dibutylphenyl)ethane-1,2-diimine (PubChem CID 87875232) has the molecular formula C30H44N2 and a molecular weight of 432.70 g/mol. Its IUPAC name is N,N'-bis(3,5-dibutylphenyl)ethane-1,2-diimine.
| Compound Name | N,N'-bis(3,5-dibutylphenyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 87875232 |
| Molecular Formula | C30H44N2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | N,N'-bis(3,5-dibutylphenyl)ethane-1,2-diimine |
| SMILES | CCCCc1cc(CCCC)cc(/N=C/C=N/c2cc(CCCC)cc(CCCC)c2)c1 |
| InChI | InChI=1S/C30H44N2/c1-5-9-13-25-19-26(14-10-6-2)22-29(21-25)31-17-18-32-30-23-27(15-11-7-3)20-28(24-30)16-12-8-4/h17-24H,5-16H2,1-4H3/b31-17+,32-18+ |
| InChIKey | DGQQZVVCVZZHAY-LTTYKRRRSA-N |
| XLogP | 9.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|