C45H72N2 — CID 87910791
1-N,2-N-bis(3,4-dipentylphenyl)tridec-3-ene-1,2-diimine (PubChem CID 87910791) has the molecular formula C45H72N2 and a molecular weight of 641.09 g/mol. Its IUPAC name is 1-N,2-N-bis(3,4-dipentylphenyl)tridec-3-ene-1,2-diimine.
| Compound Name | 1-N,2-N-bis(3,4-dipentylphenyl)tridec-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 87910791 |
| Molecular Formula | C45H72N2 |
| Molecular Weight | 641.09 g/mol |
| Exact Mass | 640.57 |
| IUPAC Name | 1-N,2-N-bis(3,4-dipentylphenyl)tridec-3-ene-1,2-diimine |
| SMILES | CCCCCCCCCC=CC(/C=N/c1ccc(CCCCC)c(CCCCC)c1)=N\c1ccc(CCCCC)c(CCCCC)c1 |
| InChI | InChI=1S/C45H72N2/c1-6-11-16-17-18-19-20-21-26-31-45(47-44-35-33-40(28-23-13-8-3)42(37-44)30-25-15-10-5)38-46-43-34-32-39(27-22-12-7-2)41(36-43)29-24-14-9-4/h26,31-38H,6-25,27-30H2,1-5H3/b31-26?,46-38+,47-45+ |
| InChIKey | UNMKKOKVTGQDHC-HYRMWCHPSA-N |
| XLogP | 14.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.09 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|