C34H52N2 — CID 87875183
1-N-(3,4-dipentylphenyl)-2-N-(3,4-dipropylphenyl)hexane-1,2-diimine (PubChem CID 87875183) has the molecular formula C34H52N2 and a molecular weight of 488.80 g/mol. Its IUPAC name is 1-N-(3,4-dipentylphenyl)-2-N-(3,4-dipropylphenyl)hexane-1,2-diimine.
| Compound Name | 1-N-(3,4-dipentylphenyl)-2-N-(3,4-dipropylphenyl)hexane-1,2-diimine |
|---|---|
| PubChem CID | 87875183 |
| Molecular Formula | C34H52N2 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.41 |
| IUPAC Name | 1-N-(3,4-dipentylphenyl)-2-N-(3,4-dipropylphenyl)hexane-1,2-diimine |
| SMILES | CCCCCc1ccc(/N=C/C(CCCC)=N/c2ccc(CCC)c(CCC)c2)cc1CCCCC |
| InChI | InChI=1S/C34H52N2/c1-6-11-14-18-29-21-23-32(25-31(29)19-15-12-7-2)35-27-34(20-13-8-3)36-33-24-22-28(16-9-4)30(26-33)17-10-5/h21-27H,6-20H2,1-5H3/b35-27+,36-34+ |
| InChIKey | PNNVMBTWMUNOKA-HRLBWIQWSA-N |
| XLogP | 10.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|