C42H56N2NiO2 — CID 87740051
1-N,2-N-bis(3,4-diethylphenyl)hexane-1,2-diimine;2-methyl-4-pentylnaphthalene-1,8-diol;nickel (PubChem CID 87740051) has the molecular formula C42H56N2NiO2 and a molecular weight of 679.62 g/mol. Its IUPAC name is 1-N,2-N-bis(3,4-diethylphenyl)hexane-1,2-diimine;2-methyl-4-pentylnaphthalene-1,8-diol;nickel.
| Compound Name | 1-N,2-N-bis(3,4-diethylphenyl)hexane-1,2-diimine;2-methyl-4-pentylnaphthalene-1,8-diol;nickel |
|---|---|
| PubChem CID | 87740051 |
| Molecular Formula | C42H56N2NiO2 |
| Molecular Weight | 679.62 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | 1-N,2-N-bis(3,4-diethylphenyl)hexane-1,2-diimine;2-methyl-4-pentylnaphthalene-1,8-diol;nickel |
| SMILES | CCCCC(/C=N/c1ccc(CC)c(CC)c1)=N\c1ccc(CC)c(CC)c1.CCCCCc1cc(C)c(O)c2c(O)cccc12.[Ni] |
| InChI | InChI=1S/C26H36N2.C16H20O2.Ni/c1-6-11-12-26(28-25-16-14-21(8-3)23(10-5)18-25)19-27-24-15-13-20(7-2)22(9-4)17-24;1-3-4-5-7-12-10-11(2)16(18)15-13(12)8-6-9-14(15)17;/h13-19H,6-12H2,1-5H3;6,8-10,17-18H,3-5,7H2,1-2H3;/b27-19+,28-26+;; |
| InChIKey | ZMOZCECUJCKMCJ-GDQIXCMOSA-N |
| XLogP | 11.89 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.62 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|