C40H51BrN2NiO2 — CID 87739741
1-N,2-N-bis(3,4-diethylphenyl)hexane-1,2-diimine;6-bromo-7-butylnaphthalene-2,3-diol;nickel (PubChem CID 87739741) has the molecular formula C40H51BrN2NiO2 and a molecular weight of 730.46 g/mol. Its IUPAC name is 1-N,2-N-bis(3,4-diethylphenyl)hexane-1,2-diimine;6-bromo-7-butylnaphthalene-2,3-diol;nickel.
| Compound Name | 1-N,2-N-bis(3,4-diethylphenyl)hexane-1,2-diimine;6-bromo-7-butylnaphthalene-2,3-diol;nickel |
|---|---|
| PubChem CID | 87739741 |
| Molecular Formula | C40H51BrN2NiO2 |
| Molecular Weight | 730.46 g/mol |
| Exact Mass | 728.25 |
| IUPAC Name | 1-N,2-N-bis(3,4-diethylphenyl)hexane-1,2-diimine;6-bromo-7-butylnaphthalene-2,3-diol;nickel |
| SMILES | CCCCC(/C=N/c1ccc(CC)c(CC)c1)=N\c1ccc(CC)c(CC)c1.CCCCc1cc2cc(O)c(O)cc2cc1Br.[Ni] |
| InChI | InChI=1S/C26H36N2.C14H15BrO2.Ni/c1-6-11-12-26(28-25-16-14-21(8-3)23(10-5)18-25)19-27-24-15-13-20(7-2)22(9-4)17-24;1-2-3-4-9-5-10-7-13(16)14(17)8-11(10)6-12(9)15;/h13-19H,6-12H2,1-5H3;5-8,16-17H,2-4H2,1H3;/b27-19+,28-26+;; |
| InChIKey | JOIQVIUETSAIIW-GDQIXCMOSA-N |
| XLogP | 11.95 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.46 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|