C27H38N2Ni — CID 87875080
1-N,2-N-bis(3,4-diethylphenyl)heptane-1,2-diimine;nickel (PubChem CID 87875080) has the molecular formula C27H38N2Ni and a molecular weight of 449.31 g/mol. Its IUPAC name is 1-N,2-N-bis(3,4-diethylphenyl)heptane-1,2-diimine;nickel.
| Compound Name | 1-N,2-N-bis(3,4-diethylphenyl)heptane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87875080 |
| Molecular Formula | C27H38N2Ni |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-N,2-N-bis(3,4-diethylphenyl)heptane-1,2-diimine;nickel |
| SMILES | CCCCCC(/C=N/c1ccc(CC)c(CC)c1)=N\c1ccc(CC)c(CC)c1.[Ni] |
| InChI | InChI=1S/C27H38N2.Ni/c1-6-11-12-13-27(29-26-17-15-22(8-3)24(10-5)19-26)20-28-25-16-14-21(7-2)23(9-4)18-25;/h14-20H,6-13H2,1-5H3;/b28-20+,29-27+; |
| InChIKey | CIZZJOXUTVZHOR-KMLUSLSTSA-N |
| XLogP | 7.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|