C28H40N2Ni — CID 87911667
1-N-(3,4-dimethylphenyl)-2-N-(3,4-dipropylphenyl)octane-1,2-diimine;nickel (PubChem CID 87911667) has the molecular formula C28H40N2Ni and a molecular weight of 463.34 g/mol. Its IUPAC name is 1-N-(3,4-dimethylphenyl)-2-N-(3,4-dipropylphenyl)octane-1,2-diimine;nickel.
| Compound Name | 1-N-(3,4-dimethylphenyl)-2-N-(3,4-dipropylphenyl)octane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87911667 |
| Molecular Formula | C28H40N2Ni |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 1-N-(3,4-dimethylphenyl)-2-N-(3,4-dipropylphenyl)octane-1,2-diimine;nickel |
| SMILES | CCCCCCC(/C=N/c1ccc(C)c(C)c1)=N\c1ccc(CCC)c(CCC)c1.[Ni] |
| InChI | InChI=1S/C28H40N2.Ni/c1-6-9-10-11-14-28(21-29-26-17-15-22(4)23(5)19-26)30-27-18-16-24(12-7-2)25(20-27)13-8-3;/h15-21H,6-14H2,1-5H3;/b29-21+,30-28+; |
| InChIKey | YXIDMXSNTIUJSI-WMBDHFFPSA-N |
| XLogP | 8.65 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|