C31H46N2Ni — CID 87912035
1-N,2-N-bis(3,4-dibutylphenyl)propane-1,2-diimine;nickel (PubChem CID 87912035) has the molecular formula C31H46N2Ni and a molecular weight of 505.42 g/mol. Its IUPAC name is 1-N,2-N-bis(3,4-dibutylphenyl)propane-1,2-diimine;nickel.
| Compound Name | 1-N,2-N-bis(3,4-dibutylphenyl)propane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87912035 |
| Molecular Formula | C31H46N2Ni |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 1-N,2-N-bis(3,4-dibutylphenyl)propane-1,2-diimine;nickel |
| SMILES | CCCCc1ccc(/N=C/C(C)=N/c2ccc(CCCC)c(CCCC)c2)cc1CCCC.[Ni] |
| InChI | InChI=1S/C31H46N2.Ni/c1-6-10-14-26-18-20-30(22-28(26)16-12-8-3)32-24-25(5)33-31-21-19-27(15-11-7-2)29(23-31)17-13-9-4;/h18-24H,6-17H2,1-5H3;/b32-24+,33-25+; |
| InChIKey | LMPWEKKVJHRCNY-FUQFKPSTSA-N |
| XLogP | 9.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|