C44H40FN7O2 — CID 161470812
4-[[4-[[4-(4-aminophenyl)iminocyclohexa-2,5-dien-1-ylidene]amino]phenyl]methyl]aniline;4-[(4-aminophenyl)methyl]aniline;1-fluoro-4-nitrobenzene (PubChem CID 161470812) has the molecular formula C44H40FN7O2 and a molecular weight of 717.85 g/mol. Its IUPAC name is 4-[[4-[[4-(4-aminophenyl)iminocyclohexa-2,5-dien-1-ylidene]amino]phenyl]methyl]aniline;4-[(4-aminophenyl)methyl]aniline;1-fluoro-4-nitrobenzene.
| Compound Name | 4-[[4-[[4-(4-aminophenyl)iminocyclohexa-2,5-dien-1-ylidene]amino]phenyl]methyl]aniline;4-[(4-aminophenyl)methyl]aniline;1-fluoro-4-nitrobenzene |
|---|---|
| PubChem CID | 161470812 |
| Molecular Formula | C44H40FN7O2 |
| Molecular Weight | 717.85 g/mol |
| Exact Mass | 717.32 |
| IUPAC Name | 4-[[4-[[4-(4-aminophenyl)iminocyclohexa-2,5-dien-1-ylidene]amino]phenyl]methyl]aniline;4-[(4-aminophenyl)methyl]aniline;1-fluoro-4-nitrobenzene |
| SMILES | Nc1ccc(Cc2ccc(N)cc2)cc1.Nc1ccc(Cc2ccc(N=C3C=CC(=Nc4ccc(N)cc4)C=C3)cc2)cc1.O=[N+]([O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C25H22N4.C13H14N2.C6H4FNO2/c26-20-5-1-18(2-6-20)17-19-3-9-22(10-4-19)28-24-13-15-25(16-14-24)29-23-11-7-21(27)8-12-23;14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;7-5-1-3-6(4-2-5)8(9)10/h1-16H,17,26-27H2;1-8H,9,14-15H2;1-4H/b28-24-,29-25+;; |
| InChIKey | WDBAIKBRUDUIOM-QIBHOWIDSA-N |
| XLogP | 9.59 |
| TPSA | 171.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.85 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|