C44H73ClN4O12S2 — CID 161472156
5-chloro-3-methyl-1,2,4-thiadiazole;1-O,1-O-ditert-butyl 6-O-ethyl hexane-1,1,6-tricarboxylate;1-O,1-O-ditert-butyl 6-O-ethyl 1-(3-methyl-1,2,4-thiadiazol-5-yl)hexane-1,1,6-tricarboxylate (PubChem CID 161472156) has the molecular formula C44H73ClN4O12S2 and a molecular weight of 949.67 g/mol. Its IUPAC name is 5-chloro-3-methyl-1,2,4-thiadiazole;1-O,1-O-ditert-butyl 6-O-ethyl hexane-1,1,6-tricarboxylate;1-O,1-O-ditert-butyl 6-O-ethyl 1-(3-methyl-1,2,4-thiadiazol-5-yl)hexane-1,1,6-tricarboxylate.
| Compound Name | 5-chloro-3-methyl-1,2,4-thiadiazole;1-O,1-O-ditert-butyl 6-O-ethyl hexane-1,1,6-tricarboxylate;1-O,1-O-ditert-butyl 6-O-ethyl 1-(3-methyl-1,2,4-thiadiazol-5-yl)hexane-1,1,6-tricarboxylate |
|---|---|
| PubChem CID | 161472156 |
| Molecular Formula | C44H73ClN4O12S2 |
| Molecular Weight | 949.67 g/mol |
| Exact Mass | 948.44 |
| IUPAC Name | 5-chloro-3-methyl-1,2,4-thiadiazole;1-O,1-O-ditert-butyl 6-O-ethyl hexane-1,1,6-tricarboxylate;1-O,1-O-ditert-butyl 6-O-ethyl 1-(3-methyl-1,2,4-thiadiazol-5-yl)hexane-1,1,6-tricarboxylate |
| SMILES | CCOC(=O)CCCCCC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)c1nc(C)ns1.CCOC(=O)CCCCCC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.Cc1nsc(Cl)n1 |
| InChI | InChI=1S/C22H36N2O6S.C19H34O6.C3H3ClN2S/c1-9-28-16(25)13-11-10-12-14-22(17-23-15(2)24-31-17,18(26)29-20(3,4)5)19(27)30-21(6,7)8;1-8-23-15(20)13-11-9-10-12-14(16(21)24-18(2,3)4)17(22)25-19(5,6)7;1-2-5-3(4)7-6-2/h9-14H2,1-8H3;14H,8-13H2,1-7H3;1H3 |
| InChIKey | WDFTXJLKZIFESF-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 209.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.67 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|