C41H43F2IN6O6 — CID 161475367
tert-butyl 2-amino-5-(4-iodophenyl)imidazole-1-carboxylate;tert-butyl 5-[4-[2-(3,5-difluorophenyl)ethynyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-1-carboxylate (PubChem CID 161475367) has the molecular formula C41H43F2IN6O6 and a molecular weight of 880.73 g/mol. Its IUPAC name is tert-butyl 2-amino-5-(4-iodophenyl)imidazole-1-carboxylate;tert-butyl 5-[4-[2-(3,5-difluorophenyl)ethynyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-1-carboxylate.
| Compound Name | tert-butyl 2-amino-5-(4-iodophenyl)imidazole-1-carboxylate;tert-butyl 5-[4-[2-(3,5-difluorophenyl)ethynyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 161475367 |
| Molecular Formula | C41H43F2IN6O6 |
| Molecular Weight | 880.73 g/mol |
| Exact Mass | 880.23 |
| IUPAC Name | tert-butyl 2-amino-5-(4-iodophenyl)imidazole-1-carboxylate;tert-butyl 5-[4-[2-(3,5-difluorophenyl)ethynyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(-c2ccc(C#Cc3cc(F)cc(F)c3)cc2)n1C(=O)OC(C)(C)C.CC(C)(C)OC(=O)n1c(-c2ccc(I)cc2)cnc1N |
| InChI | InChI=1S/C27H27F2N3O4.C14H16IN3O2/c1-26(2,3)35-24(33)31-23-30-16-22(32(23)25(34)36-27(4,5)6)19-11-9-17(10-12-19)7-8-18-13-20(28)15-21(29)14-18;1-14(2,3)20-13(19)18-11(8-17-12(18)16)9-4-6-10(15)7-5-9/h9-16H,1-6H3,(H,30,31,33);4-8H,1-3H3,(H2,16,17) |
| InChIKey | WDQGHTLLGZKPIX-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 152.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.73 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|