C16H17N3O2S — CID 53241858
tert-butyl N-[5-[2-(3-aminophenyl)ethynyl]-1,3-thiazol-4-yl]carbamate (PubChem CID 53241858) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is tert-butyl N-[5-[2-(3-aminophenyl)ethynyl]-1,3-thiazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[5-[2-(3-aminophenyl)ethynyl]-1,3-thiazol-4-yl]carbamate |
|---|---|
| PubChem CID | 53241858 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | tert-butyl N-[5-[2-(3-aminophenyl)ethynyl]-1,3-thiazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncsc1C#Cc1cccc(N)c1 |
| InChI | InChI=1S/C16H17N3O2S/c1-16(2,3)21-15(20)19-14-13(22-10-18-14)8-7-11-5-4-6-12(17)9-11/h4-6,9-10H,17H2,1-3H3,(H,19,20) |
| InChIKey | JVGBWBOFNUBWDB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|