C18H24N2O2S — CID 166894240
tert-butyl N-[5-(2-phenylbutan-2-yl)-1,3-thiazol-4-yl]carbamate (PubChem CID 166894240) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is tert-butyl N-[5-(2-phenylbutan-2-yl)-1,3-thiazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[5-(2-phenylbutan-2-yl)-1,3-thiazol-4-yl]carbamate |
|---|---|
| PubChem CID | 166894240 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | tert-butyl N-[5-(2-phenylbutan-2-yl)-1,3-thiazol-4-yl]carbamate |
| SMILES | CCC(C)(c1ccccc1)c1scnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24N2O2S/c1-6-18(5,13-10-8-7-9-11-13)14-15(19-12-23-14)20-16(21)22-17(2,3)4/h7-12H,6H2,1-5H3,(H,20,21) |
| InChIKey | OJSRDZAAUIPGNH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |