C28H29N3O2 — CID 140999725
tert-butyl N-(5-methyl-1-tritylimidazol-2-yl)carbamate (PubChem CID 140999725) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl N-(5-methyl-1-tritylimidazol-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-methyl-1-tritylimidazol-2-yl)carbamate |
|---|---|
| PubChem CID | 140999725 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | tert-butyl N-(5-methyl-1-tritylimidazol-2-yl)carbamate |
| SMILES | Cc1cnc(NC(=O)OC(C)(C)C)n1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29N3O2/c1-21-20-29-25(30-26(32)33-27(2,3)4)31(21)28(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-20H,1-4H3,(H,29,30,32) |
| InChIKey | GNJQNXBZWZAEDB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|