C19H24IN3O4 — CID 122480763
tert-butyl 4-(2-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-1-carboxylate (PubChem CID 122480763) has the molecular formula C19H24IN3O4 and a molecular weight of 485.32 g/mol. Its IUPAC name is tert-butyl 4-(2-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-(2-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 122480763 |
| Molecular Formula | C19H24IN3O4 |
| Molecular Weight | 485.32 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | tert-butyl 4-(2-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(-c2ccccc2I)cn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24IN3O4/c1-18(2,3)26-16(24)22-15-21-14(12-9-7-8-10-13(12)20)11-23(15)17(25)27-19(4,5)6/h7-11H,1-6H3,(H,21,22,24) |
| InChIKey | LYFYSLNLXBDUFR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.32 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|