C27H28N2O3S — CID 161475420
1,2-dimethyl-1-phenylhydrazine;triphenylmethanesulfonic acid (PubChem CID 161475420) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is 1,2-dimethyl-1-phenylhydrazine;triphenylmethanesulfonic acid.
| Compound Name | 1,2-dimethyl-1-phenylhydrazine;triphenylmethanesulfonic acid |
|---|---|
| PubChem CID | 161475420 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1,2-dimethyl-1-phenylhydrazine;triphenylmethanesulfonic acid |
| SMILES | CNN(C)c1ccccc1.O=S(=O)(O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16O3S.C8H12N2/c20-23(21,22)19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9-10(2)8-6-4-3-5-7-8/h1-15H,(H,20,21,22);3-7,9H,1-2H3 |
| InChIKey | WDQKEVVXEJZMQN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|