C12H19N2NaO11S3 — CID 174287353
sodium;3-(dimethylaminooxy)-2-(methylamino)-3-oxo-1-phenylpropane-1,1,2-trisulfonic acid;hydride (PubChem CID 174287353) has the molecular formula C12H19N2NaO11S3 and a molecular weight of 486.48 g/mol. Its IUPAC name is sodium;3-(dimethylaminooxy)-2-(methylamino)-3-oxo-1-phenylpropane-1,1,2-trisulfonic acid;hydride.
| Compound Name | sodium;3-(dimethylaminooxy)-2-(methylamino)-3-oxo-1-phenylpropane-1,1,2-trisulfonic acid;hydride |
|---|---|
| PubChem CID | 174287353 |
| Molecular Formula | C12H19N2NaO11S3 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | sodium;3-(dimethylaminooxy)-2-(methylamino)-3-oxo-1-phenylpropane-1,1,2-trisulfonic acid;hydride |
| SMILES | CNC(C(=O)ON(C)C)(C(c1ccccc1)(S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C12H18N2O11S3.Na.H/c1-13-11(26(16,17)18,10(15)25-14(2)3)12(27(19,20)21,28(22,23)24)9-7-5-4-6-8-9;;/h4-8,13H,1-3H3,(H,16,17,18)(H,19,20,21)(H,22,23,24);;/q;+1;-1 |
| InChIKey | NLLWZRGCUQGEAD-UHFFFAOYSA-N |
| XLogP | -4.45 |
| TPSA | 204.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|