C10H11N3O3S2 — CID 161477477
3-aminothiophene-2-carboxamide;3-aminothiophene-2-carboxylic acid (PubChem CID 161477477) has the molecular formula C10H11N3O3S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-aminothiophene-2-carboxamide;3-aminothiophene-2-carboxylic acid.
| Compound Name | 3-aminothiophene-2-carboxamide;3-aminothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 161477477 |
| Molecular Formula | C10H11N3O3S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 3-aminothiophene-2-carboxamide;3-aminothiophene-2-carboxylic acid |
| SMILES | NC(=O)c1sccc1N.Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C5H6N2OS.C5H5NO2S/c2*6-3-1-2-9-4(3)5(7)8/h1-2H,6H2,(H2,7,8);1-2H,6H2,(H,7,8) |
| InChIKey | WDXDPRNQLQLKCK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |