C17H32O2 — CID 161485600
3,3-dimethylhept-6-en-2-one;2,2-dimethylhex-5-en-1-ol (PubChem CID 161485600) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 3,3-dimethylhept-6-en-2-one;2,2-dimethylhex-5-en-1-ol.
| Compound Name | 3,3-dimethylhept-6-en-2-one;2,2-dimethylhex-5-en-1-ol |
|---|---|
| PubChem CID | 161485600 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 3,3-dimethylhept-6-en-2-one;2,2-dimethylhex-5-en-1-ol |
| SMILES | C=CCCC(C)(C)C(C)=O.C=CCCC(C)(C)CO |
| InChI | InChI=1S/C9H16O.C8H16O/c1-5-6-7-9(3,4)8(2)10;1-4-5-6-8(2,3)7-9/h5H,1,6-7H2,2-4H3;4,9H,1,5-7H2,2-3H3 |
| InChIKey | WEXYCYOHWSWRGU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|