About 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane
5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane (PubChem CID 161485798) has the molecular formula C12H29NO3
and a molecular weight of 235.37 g/mol. Its IUPAC name is 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane.
Molecular Properties
| Compound Name | 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane |
| PubChem CID | 161485798 |
| Molecular Formula | C12H29NO3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.21 |
| IUPAC Name | 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane |
| SMILES | C.C.CCC(C)CNC(O)CCCC(=O)O |
| InChI | InChI=1S/C10H21NO3.2CH4/c1-3-8(2)7-11-9(12)5-4-6-10(13)14;;/h8-9,11-12H,3-7H2,1-2H3,(H,13,14);2*1H4 |
| InChIKey | WEYNQOBSHRYDHA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane?
The IUPAC name of 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane (CID 161485798) is 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane.
What is the SMILES notation for 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane?
The canonical SMILES for 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane is C.C.CCC(C)CNC(O)CCCC(=O)O.
What is the InChIKey of 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane?
The InChIKey is WEYNQOBSHRYDHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3.2CH4/c1-3-8(2)7-11-9(12)5-4-6-10(13)14;;/h8-9,11-12H,3-7H2,1-2H3,(H,13,14);2*1H4.
What are the key properties of 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane?
5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane has a molecular weight of 235.37 g/mol, XLogP of 2.47, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-5-(2-methylbutylamino)pentanoic acid;methane is sourced from PubChem (CID 161485798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).