C21H34O2 — CID 161493322
(3R,5R,8S,9R,10S,13S,14S)-3-hydroxy-3,13,17,17-tetramethyl-2,4,5,6,7,8,9,10,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 161493322) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (3R,5R,8S,9R,10S,13S,14S)-3-hydroxy-3,13,17,17-tetramethyl-2,4,5,6,7,8,9,10,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (3R,5R,8S,9R,10S,13S,14S)-3-hydroxy-3,13,17,17-tetramethyl-2,4,5,6,7,8,9,10,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 161493322 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (3R,5R,8S,9R,10S,13S,14S)-3-hydroxy-3,13,17,17-tetramethyl-2,4,5,6,7,8,9,10,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | CC1(C)CC[C@H]2[C@@H]3CC[C@@H]4C[C@](C)(O)CC[C@@H]4[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C21H34O2/c1-19(2)9-8-16-15-6-5-13-11-20(3,23)10-7-14(13)18(15)17(22)12-21(16,19)4/h13-16,18,23H,5-12H2,1-4H3/t13-,14+,15+,16+,18-,20-,21+/m1/s1 |
| InChIKey | WFWNPPCGQFNHKW-VVYVHBGLSA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |