C28H39N3O5 — CID 161493862
(E)-but-2-enedioic acid;3-(1-cyclohexylpiperidin-4-yl)-1-(2-propan-2-ylindazol-7-yl)propan-1-one (PubChem CID 161493862) has the molecular formula C28H39N3O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(1-cyclohexylpiperidin-4-yl)-1-(2-propan-2-ylindazol-7-yl)propan-1-one.
| Compound Name | (E)-but-2-enedioic acid;3-(1-cyclohexylpiperidin-4-yl)-1-(2-propan-2-ylindazol-7-yl)propan-1-one |
|---|---|
| PubChem CID | 161493862 |
| Molecular Formula | C28H39N3O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(1-cyclohexylpiperidin-4-yl)-1-(2-propan-2-ylindazol-7-yl)propan-1-one |
| SMILES | CC(C)n1cc2cccc(C(=O)CCC3CCN(C4CCCCC4)CC3)c2n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H35N3O.C4H4O4/c1-18(2)27-17-20-7-6-10-22(24(20)25-27)23(28)12-11-19-13-15-26(16-14-19)21-8-4-3-5-9-21;5-3(6)1-2-4(7)8/h6-7,10,17-19,21H,3-5,8-9,11-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CRSYFAPBXNVQKE-WLHGVMLRSA-N |
| XLogP | 5.34 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|