C23H40O7 — CID 161498535
[(2R,4R)-5-acetyloxy-2-(5,5-dimethylhexoxy)-6-(2,2-dimethylpropanoyl)-3-methyloxan-4-yl] acetate (PubChem CID 161498535) has the molecular formula C23H40O7 and a molecular weight of 428.57 g/mol. Its IUPAC name is [(2R,4R)-5-acetyloxy-2-(5,5-dimethylhexoxy)-6-(2,2-dimethylpropanoyl)-3-methyloxan-4-yl] acetate.
| Compound Name | [(2R,4R)-5-acetyloxy-2-(5,5-dimethylhexoxy)-6-(2,2-dimethylpropanoyl)-3-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 161498535 |
| Molecular Formula | C23H40O7 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | [(2R,4R)-5-acetyloxy-2-(5,5-dimethylhexoxy)-6-(2,2-dimethylpropanoyl)-3-methyloxan-4-yl] acetate |
| SMILES | CC(=O)OC1C(C(=O)C(C)(C)C)O[C@@H](OCCCCC(C)(C)C)C(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H40O7/c1-14-17(28-15(2)24)18(29-16(3)25)19(20(26)23(7,8)9)30-21(14)27-13-11-10-12-22(4,5)6/h14,17-19,21H,10-13H2,1-9H3/t14?,17-,18?,19?,21-/m1/s1 |
| InChIKey | CNGXBXPDEZLSPV-XYLOOGEKSA-N |
| XLogP | 4.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|