About N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate
N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate (PubChem CID 162006564) has the molecular formula C7H19N4O2P
and a molecular weight of 222.23 g/mol. Its IUPAC name is N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate.
Molecular Properties
| Compound Name | N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate |
| PubChem CID | 162006564 |
| Molecular Formula | C7H19N4O2P |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate |
| SMILES | CN(C)/C(N)=N/CC(=O)OP.CNC |
| InChI | InChI=1S/C5H12N3O2P.C2H7N/c1-8(2)5(6)7-3-4(9)10-11;1-3-2/h3,11H2,1-2H3,(H2,6,7);3H,1-2H3 |
| InChIKey | YSXJGOSUUZKOCC-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate?
The IUPAC name of N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate (CID 162006564) is N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate.
What is the SMILES notation for N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate?
The canonical SMILES for N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate is CN(C)/C(N)=N/CC(=O)OP.CNC.
What is the InChIKey of N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate?
The InChIKey is YSXJGOSUUZKOCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N3O2P.C2H7N/c1-8(2)5(6)7-3-4(9)10-11;1-3-2/h3,11H2,1-2H3,(H2,6,7);3H,1-2H3.
What are the key properties of N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate?
N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate has a molecular weight of 222.23 g/mol, XLogP of -0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;phosphanyl 2-[[amino(dimethylamino)methylidene]amino]acetate is sourced from PubChem (CID 162006564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).