C32H28Cl2N2OS2 — CID 162011367
2-amino-4-methylbenzenethiol;2-[(E)-2-(4-chlorophenyl)ethenyl]-5-methyl-1,3-benzothiazole;(E)-3-(4-chlorophenyl)prop-2-enal (PubChem CID 162011367) has the molecular formula C32H28Cl2N2OS2 and a molecular weight of 591.63 g/mol. Its IUPAC name is 2-amino-4-methylbenzenethiol;2-[(E)-2-(4-chlorophenyl)ethenyl]-5-methyl-1,3-benzothiazole;(E)-3-(4-chlorophenyl)prop-2-enal.
| Compound Name | 2-amino-4-methylbenzenethiol;2-[(E)-2-(4-chlorophenyl)ethenyl]-5-methyl-1,3-benzothiazole;(E)-3-(4-chlorophenyl)prop-2-enal |
|---|---|
| PubChem CID | 162011367 |
| Molecular Formula | C32H28Cl2N2OS2 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | 2-amino-4-methylbenzenethiol;2-[(E)-2-(4-chlorophenyl)ethenyl]-5-methyl-1,3-benzothiazole;(E)-3-(4-chlorophenyl)prop-2-enal |
| SMILES | Cc1ccc(S)c(N)c1.Cc1ccc2sc(/C=C/c3ccc(Cl)cc3)nc2c1.O=C/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClNS.C9H7ClO.C7H9NS/c1-11-2-8-15-14(10-11)18-16(19-15)9-5-12-3-6-13(17)7-4-12;10-9-5-3-8(4-6-9)2-1-7-11;1-5-2-3-7(9)6(8)4-5/h2-10H,1H3;1-7H;2-4,9H,8H2,1H3/b9-5+;2-1+; |
| InChIKey | YTNGBJNZERRQJX-XPWZDBJMSA-N |
| XLogP | 9.85 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|