C14H25NO5S2 — CID 162020373
(2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-(2-methylsulfanylethyl)-4-oxohex-5-enoic acid (PubChem CID 162020373) has the molecular formula C14H25NO5S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-(2-methylsulfanylethyl)-4-oxohex-5-enoic acid.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-(2-methylsulfanylethyl)-4-oxohex-5-enoic acid |
|---|---|
| PubChem CID | 162020373 |
| Molecular Formula | C14H25NO5S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-(2-methylsulfanylethyl)-4-oxohex-5-enoic acid |
| SMILES | C=CC(=O)C[C@@H](CCSC)C(=O)O.CSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H14O3S.C5H11NO2S/c1-3-8(10)6-7(9(11)12)4-5-13-2;1-9-3-2-4(6)5(7)8/h3,7H,1,4-6H2,2H3,(H,11,12);4H,2-3,6H2,1H3,(H,7,8)/t7-;4-/m10/s1 |
| InChIKey | YURCXEAQUAFTJL-NFPGDTMVSA-N |
| XLogP | 1.74 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|