C28H31IN2O5 — CID 162026978
tert-butyl N-[(2S)-2-[(4-buta-1,3-diynylbenzoyl)amino]-4-methoxy-3-oxobutyl]carbamate;1-iodo-3-methylbenzene (PubChem CID 162026978) has the molecular formula C28H31IN2O5 and a molecular weight of 602.47 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[(4-buta-1,3-diynylbenzoyl)amino]-4-methoxy-3-oxobutyl]carbamate;1-iodo-3-methylbenzene.
| Compound Name | tert-butyl N-[(2S)-2-[(4-buta-1,3-diynylbenzoyl)amino]-4-methoxy-3-oxobutyl]carbamate;1-iodo-3-methylbenzene |
|---|---|
| PubChem CID | 162026978 |
| Molecular Formula | C28H31IN2O5 |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | tert-butyl N-[(2S)-2-[(4-buta-1,3-diynylbenzoyl)amino]-4-methoxy-3-oxobutyl]carbamate;1-iodo-3-methylbenzene |
| SMILES | C#CC#Cc1ccc(C(=O)N[C@@H](CNC(=O)OC(C)(C)C)C(=O)COC)cc1.Cc1cccc(I)c1 |
| InChI | InChI=1S/C21H24N2O5.C7H7I/c1-6-7-8-15-9-11-16(12-10-15)19(25)23-17(18(24)14-27-5)13-22-20(26)28-21(2,3)4;1-6-3-2-4-7(8)5-6/h1,9-12,17H,13-14H2,2-5H3,(H,22,26)(H,23,25);2-5H,1H3/t17-;/m0./s1 |
| InChIKey | YVMXYTNOJMLCLG-LMOVPXPDSA-N |
| XLogP | 4.11 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|