C10H22N4O2 — CID 162037116
but-2-ene;1,3-dimethylimidazolidin-2-one;urea (PubChem CID 162037116) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is but-2-ene;1,3-dimethylimidazolidin-2-one;urea.
| Compound Name | but-2-ene;1,3-dimethylimidazolidin-2-one;urea |
|---|---|
| PubChem CID | 162037116 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | but-2-ene;1,3-dimethylimidazolidin-2-one;urea |
| SMILES | CC=CC.CN1CCN(C)C1=O.NC(N)=O |
| InChI | InChI=1S/C5H10N2O.C4H8.CH4N2O/c1-6-3-4-7(2)5(6)8;1-3-4-2;2-1(3)4/h3-4H2,1-2H3;3-4H,1-2H3;(H4,2,3,4) |
| InChIKey | YWUGFWQCRVHIEA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|