C19H27N3 — CID 162049386
4-[(3aS,6aR)-3a,6a-dimethyl-5-(4-methylphenyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]butanenitrile (PubChem CID 162049386) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 4-[(3aS,6aR)-3a,6a-dimethyl-5-(4-methylphenyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]butanenitrile.
| Compound Name | 4-[(3aS,6aR)-3a,6a-dimethyl-5-(4-methylphenyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]butanenitrile |
|---|---|
| PubChem CID | 162049386 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 4-[(3aS,6aR)-3a,6a-dimethyl-5-(4-methylphenyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]butanenitrile |
| SMILES | Cc1ccc(N2C[C@]3(C)CN(CCCC#N)C[C@]3(C)C2)cc1 |
| InChI | InChI=1S/C19H27N3/c1-16-6-8-17(9-7-16)22-14-18(2)12-21(11-5-4-10-20)13-19(18,3)15-22/h6-9H,4-5,11-15H2,1-3H3/t18-,19+ |
| InChIKey | OMAZTVNEGVJCBX-KDURUIRLSA-N |
| XLogP | 3.45 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|