C23H42N6O5 — CID 162050471
tert-butyl 6-amino-2-azaspiro[3.3]heptane-2-carboxylate;tert-butyl 6-azido-2-azaspiro[3.3]heptane-2-carboxylate;methanol (PubChem CID 162050471) has the molecular formula C23H42N6O5 and a molecular weight of 482.63 g/mol. Its IUPAC name is tert-butyl 6-amino-2-azaspiro[3.3]heptane-2-carboxylate;tert-butyl 6-azido-2-azaspiro[3.3]heptane-2-carboxylate;methanol.
| Compound Name | tert-butyl 6-amino-2-azaspiro[3.3]heptane-2-carboxylate;tert-butyl 6-azido-2-azaspiro[3.3]heptane-2-carboxylate;methanol |
|---|---|
| PubChem CID | 162050471 |
| Molecular Formula | C23H42N6O5 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | tert-butyl 6-amino-2-azaspiro[3.3]heptane-2-carboxylate;tert-butyl 6-azido-2-azaspiro[3.3]heptane-2-carboxylate;methanol |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(N)C2)C1.CC(C)(C)OC(=O)N1CC2(CC(N=[N+]=[N-])C2)C1.CO |
| InChI | InChI=1S/C11H18N4O2.C11H20N2O2.CH4O/c1-10(2,3)17-9(16)15-6-11(7-15)4-8(5-11)13-14-12;1-10(2,3)15-9(14)13-6-11(7-13)4-8(12)5-11;1-2/h8H,4-7H2,1-3H3;8H,4-7,12H2,1-3H3;2H,1H3 |
| InChIKey | YYMDOYRLOVSUPX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 154.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|