C16H21F3N2O4S — CID 162054328
(2R,3aR,6aR)-1-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine (PubChem CID 162054328) has the molecular formula C16H21F3N2O4S and a molecular weight of 394.42 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine.
| Compound Name | (2R,3aR,6aR)-1-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine |
|---|---|
| PubChem CID | 162054328 |
| Molecular Formula | C16H21F3N2O4S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2R,3aR,6aR)-1-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine |
| SMILES | CNO.O=C[C@H]1C[C@H]2CCC[C@H]2N1S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NO3S.CH5NO/c16-15(17,18)11-4-6-13(7-5-11)23(21,22)19-12(9-20)8-10-2-1-3-14(10)19;1-2-3/h4-7,9-10,12,14H,1-3,8H2;2-3H,1H3/t10-,12-,14-;/m1./s1 |
| InChIKey | YYYZNBZHMIAZHY-SRVRJAHMSA-N |
| XLogP | 2.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|