C16H24N2O6S2 — CID 159057686
(2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine (PubChem CID 159057686) has the molecular formula C16H24N2O6S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine.
| Compound Name | (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine |
|---|---|
| PubChem CID | 159057686 |
| Molecular Formula | C16H24N2O6S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine |
| SMILES | CNO.CS(=O)(=O)c1ccc(S(=O)(=O)N2[C@@H]3CCC[C@@H]3C[C@@H]2C=O)cc1 |
| InChI | InChI=1S/C15H19NO5S2.CH5NO/c1-22(18,19)13-5-7-14(8-6-13)23(20,21)16-12(10-17)9-11-3-2-4-15(11)16;1-2-3/h5-8,10-12,15H,2-4,9H2,1H3;2-3H,1H3/t11-,12-,15-;/m1./s1 |
| InChIKey | JYBKIXGZHIFTFF-KEMQUXJFSA-N |
| XLogP | 0.82 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|