C15H19NO5S2 — CID 59980801
(2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde (PubChem CID 59980801) has the molecular formula C15H19NO5S2 and a molecular weight of 357.45 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde.
| Compound Name | (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 59980801 |
| Molecular Formula | C15H19NO5S2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2[C@@H]3CCC[C@@H]3C[C@@H]2C=O)cc1 |
| InChI | InChI=1S/C15H19NO5S2/c1-22(18,19)13-5-7-14(8-6-13)23(20,21)16-12(10-17)9-11-3-2-4-15(11)16/h5-8,10-12,15H,2-4,9H2,1H3/t11-,12-,15-/m1/s1 |
| InChIKey | IQSNJSCUSGXVFU-LALPHHSUSA-N |
| XLogP | 1.22 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|