C17H24N2O4S — CID 158835936
(2R,3aR,6aR)-1-[(E)-2-phenylethenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine (PubChem CID 158835936) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-[(E)-2-phenylethenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine.
| Compound Name | (2R,3aR,6aR)-1-[(E)-2-phenylethenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine |
|---|---|
| PubChem CID | 158835936 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2R,3aR,6aR)-1-[(E)-2-phenylethenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine |
| SMILES | CNO.O=C[C@H]1C[C@H]2CCC[C@H]2N1S(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H19NO3S.CH5NO/c18-12-15-11-14-7-4-8-16(14)17(15)21(19,20)10-9-13-5-2-1-3-6-13;1-2-3/h1-3,5-6,9-10,12,14-16H,4,7-8,11H2;2-3H,1H3/b10-9+;/t14-,15-,16-;/m1./s1 |
| InChIKey | IXQFOKMQUKGOFR-ZDVQTQQZSA-N |
| XLogP | 2.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|