C19H30N2O4S — CID 160722709
(2R,3aR,6aR)-1-(4-tert-butylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine (PubChem CID 160722709) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-(4-tert-butylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine.
| Compound Name | (2R,3aR,6aR)-1-(4-tert-butylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine |
|---|---|
| PubChem CID | 160722709 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (2R,3aR,6aR)-1-(4-tert-butylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carbaldehyde;N-methylhydroxylamine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2[C@@H]3CCC[C@@H]3C[C@@H]2C=O)cc1.CNO |
| InChI | InChI=1S/C18H25NO3S.CH5NO/c1-18(2,3)14-7-9-16(10-8-14)23(21,22)19-15(12-20)11-13-5-4-6-17(13)19;1-2-3/h7-10,12-13,15,17H,4-6,11H2,1-3H3;2-3H,1H3/t13-,15-,17-;/m1./s1 |
| InChIKey | RTHRPYXJWUIBEO-YOLHSKTNSA-N |
| XLogP | 2.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|