C13H26OW — CID 162055224
2,2-dimethylpentane;hexan-3-one;tungsten(2+) (PubChem CID 162055224) has the molecular formula C13H26OW and a molecular weight of 382.19 g/mol. Its IUPAC name is 2,2-dimethylpentane;hexan-3-one;tungsten(2+).
| Compound Name | 2,2-dimethylpentane;hexan-3-one;tungsten(2+) |
|---|---|
| PubChem CID | 162055224 |
| Molecular Formula | C13H26OW |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2,2-dimethylpentane;hexan-3-one;tungsten(2+) |
| SMILES | [CH2-]CCC(=O)CC.[CH2-]CCC(C)(C)C.[W+2] |
| InChI | InChI=1S/C7H15.C6H11O.W/c1-5-6-7(2,3)4;1-3-5-6(7)4-2;/h1,5-6H2,2-4H3;1,3-5H2,2H3;/q2*-1;+2 |
| InChIKey | YZBVZEVGJKHWSW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|