C14H22O4 — CID 162055645
2-ethyl-2,3-dihydropyran-4-one;2-ethyloxan-4-one (PubChem CID 162055645) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-ethyl-2,3-dihydropyran-4-one;2-ethyloxan-4-one.
| Compound Name | 2-ethyl-2,3-dihydropyran-4-one;2-ethyloxan-4-one |
|---|---|
| PubChem CID | 162055645 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-ethyl-2,3-dihydropyran-4-one;2-ethyloxan-4-one |
| SMILES | CCC1CC(=O)C=CO1.CCC1CC(=O)CCO1 |
| InChI | InChI=1S/C7H12O2.C7H10O2/c2*1-2-7-5-6(8)3-4-9-7/h7H,2-5H2,1H3;3-4,7H,2,5H2,1H3 |
| InChIKey | YZDIHAGJUDVSLK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |