C12H21NO3 — CID 20759816
9-ethyl-4-propan-2-yl-1,3-oxazonane-5,7-dione (PubChem CID 20759816) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 9-ethyl-4-propan-2-yl-1,3-oxazonane-5,7-dione.
| Compound Name | 9-ethyl-4-propan-2-yl-1,3-oxazonane-5,7-dione |
|---|---|
| PubChem CID | 20759816 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 9-ethyl-4-propan-2-yl-1,3-oxazonane-5,7-dione |
| SMILES | CCC1CC(=O)CC(=O)C(C(C)C)NCO1 |
| InChI | InChI=1S/C12H21NO3/c1-4-10-5-9(14)6-11(15)12(8(2)3)13-7-16-10/h8,10,12-13H,4-7H2,1-3H3 |
| InChIKey | VBCREGJYFXBZLI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|