C8H16N2O — CID 91522647
4-propan-2-yl-1,3-diazepan-5-one (PubChem CID 91522647) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-propan-2-yl-1,3-diazepan-5-one.
| Compound Name | 4-propan-2-yl-1,3-diazepan-5-one |
|---|---|
| PubChem CID | 91522647 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 4-propan-2-yl-1,3-diazepan-5-one |
| SMILES | CC(C)C1NCNCCC1=O |
| InChI | InChI=1S/C8H16N2O/c1-6(2)8-7(11)3-4-9-5-10-8/h6,8-10H,3-5H2,1-2H3 |
| InChIKey | MKMDNXRTWQLRGR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |