C9H12IN2Y- — CID 162066316
5-iodo-N,N,3-trimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium (PubChem CID 162066316) has the molecular formula C9H12IN2Y- and a molecular weight of 364.02 g/mol. Its IUPAC name is 5-iodo-N,N,3-trimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium.
| Compound Name | 5-iodo-N,N,3-trimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
|---|---|
| PubChem CID | 162066316 |
| Molecular Formula | C9H12IN2Y- |
| Molecular Weight | 364.02 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | 5-iodo-N,N,3-trimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
| SMILES | C=C1C(I)=CC(C)=[C-]N1N(C)C.[Y] |
| InChI | InChI=1S/C9H12IN2.Y/c1-7-5-9(10)8(2)12(6-7)11(3)4;/h5H,2H2,1,3-4H3;/q-1; |
| InChIKey | SBWVXBMCYBCYFC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.02 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|