C8H9INY- — CID 160920057
5-iodo-1,3-dimethyl-6-methylidene-2H-pyridin-2-ide;yttrium (PubChem CID 160920057) has the molecular formula C8H9INY- and a molecular weight of 334.98 g/mol. Its IUPAC name is 5-iodo-1,3-dimethyl-6-methylidene-2H-pyridin-2-ide;yttrium.
| Compound Name | 5-iodo-1,3-dimethyl-6-methylidene-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 160920057 |
| Molecular Formula | C8H9INY- |
| Molecular Weight | 334.98 g/mol |
| Exact Mass | 334.88 |
| IUPAC Name | 5-iodo-1,3-dimethyl-6-methylidene-2H-pyridin-2-ide;yttrium |
| SMILES | C=C1C(I)=CC(C)=[C-]N1C.[Y] |
| InChI | InChI=1S/C8H9IN.Y/c1-6-4-8(9)7(2)10(3)5-6;/h4H,2H2,1,3H3;/q-1; |
| InChIKey | ATWZZSSALWZFTC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.98 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|