C10H15N2Y- — CID 159654490
N,N,3,5-tetramethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium (PubChem CID 159654490) has the molecular formula C10H15N2Y- and a molecular weight of 252.15 g/mol. Its IUPAC name is N,N,3,5-tetramethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium.
| Compound Name | N,N,3,5-tetramethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
|---|---|
| PubChem CID | 159654490 |
| Molecular Formula | C10H15N2Y- |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | N,N,3,5-tetramethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
| SMILES | C=C1C(C)=CC(C)=[C-]N1N(C)C.[Y] |
| InChI | InChI=1S/C10H15N2.Y/c1-8-6-9(2)10(3)12(7-8)11(4)5;/h6H,3H2,1-2,4-5H3;/q-1; |
| InChIKey | DXPHPWCIWUOVPZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|