C8H15N6+ — CID 162078947
1,4-dimethyltriazole;1,4-dimethyl-4H-triazol-1-ium (PubChem CID 162078947) has the molecular formula C8H15N6+ and a molecular weight of 195.25 g/mol. Its IUPAC name is 1,4-dimethyltriazole;1,4-dimethyl-4H-triazol-1-ium.
| Compound Name | 1,4-dimethyltriazole;1,4-dimethyl-4H-triazol-1-ium |
|---|---|
| PubChem CID | 162078947 |
| Molecular Formula | C8H15N6+ |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1,4-dimethyltriazole;1,4-dimethyl-4H-triazol-1-ium |
| SMILES | CC1C=[N+](C)N=N1.Cc1cn(C)nn1 |
| InChI | InChI=1S/C4H8N3.C4H7N3/c2*1-4-3-7(2)6-5-4/h3-4H,1-2H3;3H,1-2H3/q+1; |
| InChIKey | VCADOFXQNMZELC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|