C36H49N3O6S2 — CID 162083858
triethylazanium;1,3,3-trimethyl-2-[4-methyl-7-(1,3,3-trimethyl-5-oxidoperoxysulfanylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole-5-sulfonate (PubChem CID 162083858) has the molecular formula C36H49N3O6S2 and a molecular weight of 683.94 g/mol. Its IUPAC name is triethylazanium;1,3,3-trimethyl-2-[4-methyl-7-(1,3,3-trimethyl-5-oxidoperoxysulfanylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole-5-sulfonate.
| Compound Name | triethylazanium;1,3,3-trimethyl-2-[4-methyl-7-(1,3,3-trimethyl-5-oxidoperoxysulfanylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole-5-sulfonate |
|---|---|
| PubChem CID | 162083858 |
| Molecular Formula | C36H49N3O6S2 |
| Molecular Weight | 683.94 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | triethylazanium;1,3,3-trimethyl-2-[4-methyl-7-(1,3,3-trimethyl-5-oxidoperoxysulfanylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole-5-sulfonate |
| SMILES | CC(C=CC=C1N(C)c2ccc(S(=O)(=O)[O-])cc2C1(C)C)=CC=CC1=[N+](C)c2ccc(SOO[O-])cc2C1(C)C.CC[NH+](CC)CC |
| InChI | InChI=1S/C30H34N2O6S2.C6H15N/c1-20(10-8-12-27-29(2,3)23-18-21(39-38-37-33)14-16-25(23)31(27)6)11-9-13-28-30(4,5)24-19-22(40(34,35)36)15-17-26(24)32(28)7;1-4-7(5-2)6-3/h8-19H,1-7H3,(H-,33,34,35,36);4-6H2,1-3H3 |
| InChIKey | NJJUIRJQVDNDGP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.94 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|