C22H25N3O6 — CID 162092028
6-nitro-1-propyl-4H-3,1-benzoxazin-2-one;1-propyl-4H-3,1-benzoxazin-2-one (PubChem CID 162092028) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is 6-nitro-1-propyl-4H-3,1-benzoxazin-2-one;1-propyl-4H-3,1-benzoxazin-2-one.
| Compound Name | 6-nitro-1-propyl-4H-3,1-benzoxazin-2-one;1-propyl-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 162092028 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 6-nitro-1-propyl-4H-3,1-benzoxazin-2-one;1-propyl-4H-3,1-benzoxazin-2-one |
| SMILES | CCCN1C(=O)OCc2cc([N+](=O)[O-])ccc21.CCCN1C(=O)OCc2ccccc21 |
| InChI | InChI=1S/C11H12N2O4.C11H13NO2/c1-2-5-12-10-4-3-9(13(15)16)6-8(10)7-17-11(12)14;1-2-7-12-10-6-4-3-5-9(10)8-14-11(12)13/h3-4,6H,2,5,7H2,1H3;3-6H,2,7-8H2,1H3 |
| InChIKey | ZDTAXFDSPSUAEK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|