C22H30N2-2 — CID 162092887
5-ethyl-3-methyl-8-[(Z)-pent-1-enyl]-4-propyl-3aH-imidazo[1,2-a]quinoline-5a,8-diide (PubChem CID 162092887) has the molecular formula C22H30N2-2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 5-ethyl-3-methyl-8-[(Z)-pent-1-enyl]-4-propyl-3aH-imidazo[1,2-a]quinoline-5a,8-diide.
| Compound Name | 5-ethyl-3-methyl-8-[(Z)-pent-1-enyl]-4-propyl-3aH-imidazo[1,2-a]quinoline-5a,8-diide |
|---|---|
| PubChem CID | 162092887 |
| Molecular Formula | C22H30N2-2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 5-ethyl-3-methyl-8-[(Z)-pent-1-enyl]-4-propyl-3aH-imidazo[1,2-a]quinoline-5a,8-diide |
| SMILES | CCC/C=C\[C-]1C=C[C-]2C(=C1)N1C=CN(C)C1C(CCC)=C2CC |
| InChI | InChI=1S/C22H30N2/c1-5-8-9-11-17-12-13-19-18(7-3)20(10-6-2)22-23(4)14-15-24(22)21(19)16-17/h9,11-16,22H,5-8,10H2,1-4H3/q-2/b11-9- |
| InChIKey | IVSZNXCSUAIIPH-LUAWRHEFSA-N |
| XLogP | 5.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|