C21H30N2 — CID 123754159
1,3-bis(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-2H-imidazole (PubChem CID 123754159) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-2H-imidazole.
| Compound Name | 1,3-bis(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-2H-imidazole |
|---|---|
| PubChem CID | 123754159 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-2H-imidazole |
| SMILES | CC1=CC(C)=C(N2C=CN(C3=C(C)C=C(C)CC3C)C2)C(C)C1 |
| InChI | InChI=1S/C21H30N2/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6/h7-9,11,17,19H,10,12-13H2,1-6H3 |
| InChIKey | UWUYWKVLQISZKV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |